C12H17N3S — CID 65257502
2,2-dimethyl-5-(4-methylpyrimidin-2-yl)sulfanylpentanenitrile (PubChem CID 65257502) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 2,2-dimethyl-5-(4-methylpyrimidin-2-yl)sulfanylpentanenitrile.
| Compound Name | 2,2-dimethyl-5-(4-methylpyrimidin-2-yl)sulfanylpentanenitrile |
|---|---|
| PubChem CID | 65257502 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2,2-dimethyl-5-(4-methylpyrimidin-2-yl)sulfanylpentanenitrile |
| SMILES | Cc1ccnc(SCCCC(C)(C)C#N)n1 |
| InChI | InChI=1S/C12H17N3S/c1-10-5-7-14-11(15-10)16-8-4-6-12(2,3)9-13/h5,7H,4,6,8H2,1-3H3 |
| InChIKey | FYRSYFKPJVZMNO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|