C12H20ClN3S — CID 72716663
4-methyl-2-(2-piperidin-4-ylethylsulfanyl)pyrimidine;hydrochloride (PubChem CID 72716663) has the molecular formula C12H20ClN3S and a molecular weight of 273.83 g/mol. Its IUPAC name is 4-methyl-2-(2-piperidin-4-ylethylsulfanyl)pyrimidine;hydrochloride.
| Compound Name | 4-methyl-2-(2-piperidin-4-ylethylsulfanyl)pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 72716663 |
| Molecular Formula | C12H20ClN3S |
| Molecular Weight | 273.83 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 4-methyl-2-(2-piperidin-4-ylethylsulfanyl)pyrimidine;hydrochloride |
| SMILES | Cc1ccnc(SCCC2CCNCC2)n1.Cl |
| InChI | InChI=1S/C12H19N3S.ClH/c1-10-2-8-14-12(15-10)16-9-5-11-3-6-13-7-4-11;/h2,8,11,13H,3-7,9H2,1H3;1H |
| InChIKey | SRJAQFFEIIXUJJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.83 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |