C16H26ClNOS — CID 106810893
5-(2-chlorophenyl)sulfanyl-2-ethyl-2-(propylamino)pentan-1-ol (PubChem CID 106810893) has the molecular formula C16H26ClNOS and a molecular weight of 315.91 g/mol. Its IUPAC name is 5-(2-chlorophenyl)sulfanyl-2-ethyl-2-(propylamino)pentan-1-ol.
| Compound Name | 5-(2-chlorophenyl)sulfanyl-2-ethyl-2-(propylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106810893 |
| Molecular Formula | C16H26ClNOS |
| Molecular Weight | 315.91 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 5-(2-chlorophenyl)sulfanyl-2-ethyl-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(CC)(CO)CCCSc1ccccc1Cl |
| InChI | InChI=1S/C16H26ClNOS/c1-3-11-18-16(4-2,13-19)10-7-12-20-15-9-6-5-8-14(15)17/h5-6,8-9,18-19H,3-4,7,10-13H2,1-2H3 |
| InChIKey | PZDQMPYZGJMCHZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.91 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|