C14H28N4OS — CID 106810829
5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-ethyl-2-(propylamino)pentan-1-ol (PubChem CID 106810829) has the molecular formula C14H28N4OS and a molecular weight of 300.47 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-ethyl-2-(propylamino)pentan-1-ol.
| Compound Name | 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-ethyl-2-(propylamino)pentan-1-ol |
|---|---|
| PubChem CID | 106810829 |
| Molecular Formula | C14H28N4OS |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-ethyl-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(CC)(CO)CCCSc1nnc(C)n1C |
| InChI | InChI=1S/C14H28N4OS/c1-5-9-15-14(6-2,11-19)8-7-10-20-13-17-16-12(3)18(13)4/h15,19H,5-11H2,1-4H3 |
| InChIKey | CRKZHNNIEGCBLL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|