C13H17NO3 — CID 10681256
methyl (4aR,8aR)-6,7-dimethyl-1-oxo-4a,5,8,8a-tetrahydro-2H-isoquinoline-3-carboxylate (PubChem CID 10681256) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is methyl (4aR,8aR)-6,7-dimethyl-1-oxo-4a,5,8,8a-tetrahydro-2H-isoquinoline-3-carboxylate.
| Compound Name | methyl (4aR,8aR)-6,7-dimethyl-1-oxo-4a,5,8,8a-tetrahydro-2H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10681256 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl (4aR,8aR)-6,7-dimethyl-1-oxo-4a,5,8,8a-tetrahydro-2H-isoquinoline-3-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2CC(C)=C(C)C[C@H]2C(=O)N1 |
| InChI | InChI=1S/C13H17NO3/c1-7-4-9-6-11(13(16)17-3)14-12(15)10(9)5-8(7)2/h6,9-10H,4-5H2,1-3H3,(H,14,15)/t9-,10-/m1/s1 |
| InChIKey | DJGXSZLPDRVHGU-NXEZZACHSA-N |
| XLogP | 1.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|