C12H18ClNOS — CID 106817133
N-[(3-chloro-4-methylphenyl)methyl]-1-methylsulfinylpropan-2-amine (PubChem CID 106817133) has the molecular formula C12H18ClNOS and a molecular weight of 259.80 g/mol. Its IUPAC name is N-[(3-chloro-4-methylphenyl)methyl]-1-methylsulfinylpropan-2-amine.
| Compound Name | N-[(3-chloro-4-methylphenyl)methyl]-1-methylsulfinylpropan-2-amine |
|---|---|
| PubChem CID | 106817133 |
| Molecular Formula | C12H18ClNOS |
| Molecular Weight | 259.80 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[(3-chloro-4-methylphenyl)methyl]-1-methylsulfinylpropan-2-amine |
| SMILES | Cc1ccc(CNC(C)CS(C)=O)cc1Cl |
| InChI | InChI=1S/C12H18ClNOS/c1-9-4-5-11(6-12(9)13)7-14-10(2)8-16(3)15/h4-6,10,14H,7-8H2,1-3H3 |
| InChIKey | NMCKCEXGDJNXPU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.80 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |