C15H26ClNO3 — CID 145435767
2-[(3-chloro-4-methylphenyl)methylamino]-3-hydroxypropanoic acid;ethane (PubChem CID 145435767) has the molecular formula C15H26ClNO3 and a molecular weight of 303.83 g/mol. Its IUPAC name is 2-[(3-chloro-4-methylphenyl)methylamino]-3-hydroxypropanoic acid;ethane.
| Compound Name | 2-[(3-chloro-4-methylphenyl)methylamino]-3-hydroxypropanoic acid;ethane |
|---|---|
| PubChem CID | 145435767 |
| Molecular Formula | C15H26ClNO3 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[(3-chloro-4-methylphenyl)methylamino]-3-hydroxypropanoic acid;ethane |
| SMILES | CC.CC.Cc1ccc(CNC(CO)C(=O)O)cc1Cl |
| InChI | InChI=1S/C11H14ClNO3.2C2H6/c1-7-2-3-8(4-9(7)12)5-13-10(6-14)11(15)16;2*1-2/h2-4,10,13-14H,5-6H2,1H3,(H,15,16);2*1-2H3 |
| InChIKey | ININIENGZKEVHR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |