C11H13Cl2NO — CID 106818464
2-chloro-2-(3-chloro-4-methylphenyl)-N,N-dimethylacetamide (PubChem CID 106818464) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is 2-chloro-2-(3-chloro-4-methylphenyl)-N,N-dimethylacetamide.
| Compound Name | 2-chloro-2-(3-chloro-4-methylphenyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 106818464 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-chloro-2-(3-chloro-4-methylphenyl)-N,N-dimethylacetamide |
| SMILES | Cc1ccc(C(Cl)C(=O)N(C)C)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NO/c1-7-4-5-8(6-9(7)12)10(13)11(15)14(2)3/h4-6,10H,1-3H3 |
| InChIKey | RPUIOQVEPMQHSX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|