C17H18Cl2N2 — CID 106820286
N-(2,3-dichlorophenyl)-1-phenylpiperidin-4-amine (PubChem CID 106820286) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-1-phenylpiperidin-4-amine.
| Compound Name | N-(2,3-dichlorophenyl)-1-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 106820286 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(2,3-dichlorophenyl)-1-phenylpiperidin-4-amine |
| SMILES | Clc1cccc(NC2CCN(c3ccccc3)CC2)c1Cl |
| InChI | InChI=1S/C17H18Cl2N2/c18-15-7-4-8-16(17(15)19)20-13-9-11-21(12-10-13)14-5-2-1-3-6-14/h1-8,13,20H,9-12H2 |
| InChIKey | YFVLJPDCCZGBGW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |