C11H19N3O — CID 106824899
2-ethoxy-5-prop-2-enyl-5,7-diazaspiro[3.4]oct-6-en-6-amine (PubChem CID 106824899) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-ethoxy-5-prop-2-enyl-5,7-diazaspiro[3.4]oct-6-en-6-amine.
| Compound Name | 2-ethoxy-5-prop-2-enyl-5,7-diazaspiro[3.4]oct-6-en-6-amine |
|---|---|
| PubChem CID | 106824899 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-ethoxy-5-prop-2-enyl-5,7-diazaspiro[3.4]oct-6-en-6-amine |
| SMILES | C=CCN1C(N)=NCC12CC(OCC)C2 |
| InChI | InChI=1S/C11H19N3O/c1-3-5-14-10(12)13-8-11(14)6-9(7-11)15-4-2/h3,9H,1,4-8H2,2H3,(H2,12,13) |
| InChIKey | QNVJZHBMUKEFIF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|