C15H20N2O2 — CID 106825185
[4-(imidazo[1,2-a]pyridin-2-ylmethoxy)cyclohexyl]methanol (PubChem CID 106825185) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [4-(imidazo[1,2-a]pyridin-2-ylmethoxy)cyclohexyl]methanol.
| Compound Name | [4-(imidazo[1,2-a]pyridin-2-ylmethoxy)cyclohexyl]methanol |
|---|---|
| PubChem CID | 106825185 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [4-(imidazo[1,2-a]pyridin-2-ylmethoxy)cyclohexyl]methanol |
| SMILES | OCC1CCC(OCc2cn3ccccc3n2)CC1 |
| InChI | InChI=1S/C15H20N2O2/c18-10-12-4-6-14(7-5-12)19-11-13-9-17-8-2-1-3-15(17)16-13/h1-3,8-9,12,14,18H,4-7,10-11H2 |
| InChIKey | STZFKBFLZPGZGH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |