C15H12Br2N2O2 — CID 107739058
[3,5-dibromo-4-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]methanol (PubChem CID 107739058) has the molecular formula C15H12Br2N2O2 and a molecular weight of 412.08 g/mol. Its IUPAC name is [3,5-dibromo-4-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]methanol.
| Compound Name | [3,5-dibromo-4-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 107739058 |
| Molecular Formula | C15H12Br2N2O2 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | [3,5-dibromo-4-(imidazo[1,2-a]pyridin-2-ylmethoxy)phenyl]methanol |
| SMILES | OCc1cc(Br)c(OCc2cn3ccccc3n2)c(Br)c1 |
| InChI | InChI=1S/C15H12Br2N2O2/c16-12-5-10(8-20)6-13(17)15(12)21-9-11-7-19-4-2-1-3-14(19)18-11/h1-7,20H,8-9H2 |
| InChIKey | AGMYCNQRQPHKTP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |