C12H13F3N2O — CID 10682613
3-benzyl-2-methyl-5-(trifluoromethyl)-4H-imidazol-5-ol (PubChem CID 10682613) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is 3-benzyl-2-methyl-5-(trifluoromethyl)-4H-imidazol-5-ol.
| Compound Name | 3-benzyl-2-methyl-5-(trifluoromethyl)-4H-imidazol-5-ol |
|---|---|
| PubChem CID | 10682613 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-benzyl-2-methyl-5-(trifluoromethyl)-4H-imidazol-5-ol |
| SMILES | CC1=NC(O)(C(F)(F)F)CN1Cc1ccccc1 |
| InChI | InChI=1S/C12H13F3N2O/c1-9-16-11(18,12(13,14)15)8-17(9)7-10-5-3-2-4-6-10/h2-6,18H,7-8H2,1H3 |
| InChIKey | FYKNOBUOPINYKT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |