C15H20N2O2S — CID 106827829
2-(1-methylcyclohexyl)-6-methylsulfonyl-1H-benzimidazole (PubChem CID 106827829) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-(1-methylcyclohexyl)-6-methylsulfonyl-1H-benzimidazole.
| Compound Name | 2-(1-methylcyclohexyl)-6-methylsulfonyl-1H-benzimidazole |
|---|---|
| PubChem CID | 106827829 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-(1-methylcyclohexyl)-6-methylsulfonyl-1H-benzimidazole |
| SMILES | CC1(c2nc3ccc(S(C)(=O)=O)cc3[nH]2)CCCCC1 |
| InChI | InChI=1S/C15H20N2O2S/c1-15(8-4-3-5-9-15)14-16-12-7-6-11(20(2,18)19)10-13(12)17-14/h6-7,10H,3-5,8-9H2,1-2H3,(H,16,17) |
| InChIKey | PEFVNDVDCLOPBF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |