C16H22N2 — CID 173176716
2-(1-methylcyclooctyl)-1H-benzimidazole (PubChem CID 173176716) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-(1-methylcyclooctyl)-1H-benzimidazole.
| Compound Name | 2-(1-methylcyclooctyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 173176716 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-(1-methylcyclooctyl)-1H-benzimidazole |
| SMILES | CC1(c2nc3ccccc3[nH]2)CCCCCCC1 |
| InChI | InChI=1S/C16H22N2/c1-16(11-7-3-2-4-8-12-16)15-17-13-9-5-6-10-14(13)18-15/h5-6,9-10H,2-4,7-8,11-12H2,1H3,(H,17,18) |
| InChIKey | ZXSFRMCQPVLLOQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |