C15H17F3N2 — CID 106827844
2-(1-methylcyclohexyl)-6-(trifluoromethyl)-1H-benzimidazole (PubChem CID 106827844) has the molecular formula C15H17F3N2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-(1-methylcyclohexyl)-6-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 2-(1-methylcyclohexyl)-6-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 106827844 |
| Molecular Formula | C15H17F3N2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-(1-methylcyclohexyl)-6-(trifluoromethyl)-1H-benzimidazole |
| SMILES | CC1(c2nc3ccc(C(F)(F)F)cc3[nH]2)CCCCC1 |
| InChI | InChI=1S/C15H17F3N2/c1-14(7-3-2-4-8-14)13-19-11-6-5-10(15(16,17)18)9-12(11)20-13/h5-6,9H,2-4,7-8H2,1H3,(H,19,20) |
| InChIKey | RSDWXHPJJWFCPU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |