C13H18N2O5 — CID 139077353
trans-(1R,3R)-5-(1H-benzimidazol-2-yl)cyclohexane-1,2,3,5-tetrol;hydrate (PubChem CID 139077353) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is trans-(1R,3R)-5-(1H-benzimidazol-2-yl)cyclohexane-1,2,3,5-tetrol;hydrate.
| Compound Name | trans-(1R,3R)-5-(1H-benzimidazol-2-yl)cyclohexane-1,2,3,5-tetrol;hydrate |
|---|---|
| PubChem CID | 139077353 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | trans-(1R,3R)-5-(1H-benzimidazol-2-yl)cyclohexane-1,2,3,5-tetrol;hydrate |
| SMILES | O.OC1[C@H](O)CC(O)(c2nc3ccccc3[nH]2)C[C@H]1O |
| InChI | InChI=1S/C13H16N2O4.H2O/c16-9-5-13(19,6-10(17)11(9)18)12-14-7-3-1-2-4-8(7)15-12;/h1-4,9-11,16-19H,5-6H2,(H,14,15);1H2/t9-,10-,11?,13?;/m1./s1 |
| InChIKey | GPLSZKUQQZSOJV-JMCAUHRNSA-N |
| XLogP | -1.20 |
| TPSA | 141.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |