C16H27N3 — CID 10682857
(E)-N,N-diethyl-2-(2,5,6-triethylpyrimidin-4-yl)ethenamine (PubChem CID 10682857) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (E)-N,N-diethyl-2-(2,5,6-triethylpyrimidin-4-yl)ethenamine.
| Compound Name | (E)-N,N-diethyl-2-(2,5,6-triethylpyrimidin-4-yl)ethenamine |
|---|---|
| PubChem CID | 10682857 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (E)-N,N-diethyl-2-(2,5,6-triethylpyrimidin-4-yl)ethenamine |
| SMILES | CCc1nc(/C=C/N(CC)CC)c(CC)c(CC)n1 |
| InChI | InChI=1S/C16H27N3/c1-6-13-14(7-2)17-16(8-3)18-15(13)11-12-19(9-4)10-5/h11-12H,6-10H2,1-5H3/b12-11+ |
| InChIKey | ZNHQBASJSXQYJR-VAWYXSNFSA-N |
| XLogP | 3.48 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |