C12H27N3O2 — CID 106841213
4-amino-N,N-diethyl-3-(4-hydroxybutylamino)butanamide (PubChem CID 106841213) has the molecular formula C12H27N3O2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 4-amino-N,N-diethyl-3-(4-hydroxybutylamino)butanamide.
| Compound Name | 4-amino-N,N-diethyl-3-(4-hydroxybutylamino)butanamide |
|---|---|
| PubChem CID | 106841213 |
| Molecular Formula | C12H27N3O2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 4-amino-N,N-diethyl-3-(4-hydroxybutylamino)butanamide |
| SMILES | CCN(CC)C(=O)CC(CN)NCCCCO |
| InChI | InChI=1S/C12H27N3O2/c1-3-15(4-2)12(17)9-11(10-13)14-7-5-6-8-16/h11,14,16H,3-10,13H2,1-2H3 |
| InChIKey | GGPHIDZMHWQSTA-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|