C12H26N2O2 — CID 115906805
3-(6-hydroxyhexylamino)-N,N-dimethylbutanamide (PubChem CID 115906805) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(6-hydroxyhexylamino)-N,N-dimethylbutanamide.
| Compound Name | 3-(6-hydroxyhexylamino)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 115906805 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-(6-hydroxyhexylamino)-N,N-dimethylbutanamide |
| SMILES | CC(CC(=O)N(C)C)NCCCCCCO |
| InChI | InChI=1S/C12H26N2O2/c1-11(10-12(16)14(2)3)13-8-6-4-5-7-9-15/h11,13,15H,4-10H2,1-3H3 |
| InChIKey | SKCCQIFVXNOVKP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|