C16H28O2Si — CID 10684190
3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde (PubChem CID 10684190) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is 3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde.
| Compound Name | 3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 10684190 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3-but-3-enyl-2,2-dimethyl-1-trimethylsilyloxycyclohex-3-ene-1-carbaldehyde |
| SMILES | C=CCCC1=CCCC(C=O)(O[Si](C)(C)C)C1(C)C |
| InChI | InChI=1S/C16H28O2Si/c1-7-8-10-14-11-9-12-16(13-17,15(14,2)3)18-19(4,5)6/h7,11,13H,1,8-10,12H2,2-6H3 |
| InChIKey | QNGTUWJMELQKHH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|