C16H17BrFNS — CID 106848642
2-(5-bromo-2-fluorophenyl)-1-(4-ethylsulfanylphenyl)ethanamine (PubChem CID 106848642) has the molecular formula C16H17BrFNS and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-1-(4-ethylsulfanylphenyl)ethanamine.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-1-(4-ethylsulfanylphenyl)ethanamine |
|---|---|
| PubChem CID | 106848642 |
| Molecular Formula | C16H17BrFNS |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-1-(4-ethylsulfanylphenyl)ethanamine |
| SMILES | CCSc1ccc(C(N)Cc2cc(Br)ccc2F)cc1 |
| InChI | InChI=1S/C16H17BrFNS/c1-2-20-14-6-3-11(4-7-14)16(19)10-12-9-13(17)5-8-15(12)18/h3-9,16H,2,10,19H2,1H3 |
| InChIKey | PHNOJZLHPWUJAD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |