C14H23NO4Si — CID 10685433
N-(2,5-dimethoxyphenyl)-N-(trimethylsilyloxymethyl)acetamide (PubChem CID 10685433) has the molecular formula C14H23NO4Si and a molecular weight of 297.43 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-N-(trimethylsilyloxymethyl)acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-N-(trimethylsilyloxymethyl)acetamide |
|---|---|
| PubChem CID | 10685433 |
| Molecular Formula | C14H23NO4Si |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-N-(trimethylsilyloxymethyl)acetamide |
| SMILES | COc1ccc(OC)c(N(CO[Si](C)(C)C)C(C)=O)c1 |
| InChI | InChI=1S/C14H23NO4Si/c1-11(16)15(10-19-20(4,5)6)13-9-12(17-2)7-8-14(13)18-3/h7-9H,10H2,1-6H3 |
| InChIKey | QWNJLLJHOCGHOS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|