C12H8Br2F2O — CID 106856036
2-bromo-3-[1-bromo-2-(2,3-difluorophenyl)ethyl]furan (PubChem CID 106856036) has the molecular formula C12H8Br2F2O and a molecular weight of 366.00 g/mol. Its IUPAC name is 2-bromo-3-[1-bromo-2-(2,3-difluorophenyl)ethyl]furan.
| Compound Name | 2-bromo-3-[1-bromo-2-(2,3-difluorophenyl)ethyl]furan |
|---|---|
| PubChem CID | 106856036 |
| Molecular Formula | C12H8Br2F2O |
| Molecular Weight | 366.00 g/mol |
| Exact Mass | 363.89 |
| IUPAC Name | 2-bromo-3-[1-bromo-2-(2,3-difluorophenyl)ethyl]furan |
| SMILES | Fc1cccc(CC(Br)c2ccoc2Br)c1F |
| InChI | InChI=1S/C12H8Br2F2O/c13-9(8-4-5-17-12(8)14)6-7-2-1-3-10(15)11(7)16/h1-5,9H,6H2 |
| InChIKey | JRLBVFCFTGPAID-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.00 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|