C15H18ClN3O — CID 106863632
N-[3-[5-(2-chloro-4-methylphenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine (PubChem CID 106863632) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is N-[3-[5-(2-chloro-4-methylphenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine.
| Compound Name | N-[3-[5-(2-chloro-4-methylphenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine |
|---|---|
| PubChem CID | 106863632 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-[3-[5-(2-chloro-4-methylphenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine |
| SMILES | Cc1ccc(-c2nnc(CCCNC3CC3)o2)c(Cl)c1 |
| InChI | InChI=1S/C15H18ClN3O/c1-10-4-7-12(13(16)9-10)15-19-18-14(20-15)3-2-8-17-11-5-6-11/h4,7,9,11,17H,2-3,5-6,8H2,1H3 |
| InChIKey | RRVKIVKJHBDZBH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|