C14H15ClFN3O — CID 62139131
N-[3-[5-(5-chloro-2-fluorophenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine (PubChem CID 62139131) has the molecular formula C14H15ClFN3O and a molecular weight of 295.75 g/mol. Its IUPAC name is N-[3-[5-(5-chloro-2-fluorophenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine.
| Compound Name | N-[3-[5-(5-chloro-2-fluorophenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine |
|---|---|
| PubChem CID | 62139131 |
| Molecular Formula | C14H15ClFN3O |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[3-[5-(5-chloro-2-fluorophenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine |
| SMILES | Fc1ccc(Cl)cc1-c1nnc(CCCNC2CC2)o1 |
| InChI | InChI=1S/C14H15ClFN3O/c15-9-3-6-12(16)11(8-9)14-19-18-13(20-14)2-1-7-17-10-4-5-10/h3,6,8,10,17H,1-2,4-5,7H2 |
| InChIKey | FIBAPRSSSZQVFV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|