C14H15BrFN3O — CID 62137997
N-[3-[5-(2-bromo-5-fluorophenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine (PubChem CID 62137997) has the molecular formula C14H15BrFN3O and a molecular weight of 340.20 g/mol. Its IUPAC name is N-[3-[5-(2-bromo-5-fluorophenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine.
| Compound Name | N-[3-[5-(2-bromo-5-fluorophenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine |
|---|---|
| PubChem CID | 62137997 |
| Molecular Formula | C14H15BrFN3O |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-[3-[5-(2-bromo-5-fluorophenyl)-1,3,4-oxadiazol-2-yl]propyl]cyclopropanamine |
| SMILES | Fc1ccc(Br)c(-c2nnc(CCCNC3CC3)o2)c1 |
| InChI | InChI=1S/C14H15BrFN3O/c15-12-6-3-9(16)8-11(12)14-19-18-13(20-14)2-1-7-17-10-4-5-10/h3,6,8,10,17H,1-2,4-5,7H2 |
| InChIKey | NLHOAXCPXMGMJP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|