C12H15ClO3S — CID 106869012
2-[(2-chloro-4-methylphenyl)methylsulfinyl]-2-methylpropanoic acid (PubChem CID 106869012) has the molecular formula C12H15ClO3S and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-[(2-chloro-4-methylphenyl)methylsulfinyl]-2-methylpropanoic acid.
| Compound Name | 2-[(2-chloro-4-methylphenyl)methylsulfinyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 106869012 |
| Molecular Formula | C12H15ClO3S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-[(2-chloro-4-methylphenyl)methylsulfinyl]-2-methylpropanoic acid |
| SMILES | Cc1ccc(CS(=O)C(C)(C)C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClO3S/c1-8-4-5-9(10(13)6-8)7-17(16)12(2,3)11(14)15/h4-6H,7H2,1-3H3,(H,14,15) |
| InChIKey | MQHJMRUEMBJTSF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |