C10H14F3NO5S — CID 10686951
methyl (2S,4S)-4-acetylsulfanylpyrrolidin-1-ium-2-carboxylate;2,2,2-trifluoroacetate (PubChem CID 10686951) has the molecular formula C10H14F3NO5S and a molecular weight of 317.29 g/mol. Its IUPAC name is methyl (2S,4S)-4-acetylsulfanylpyrrolidin-1-ium-2-carboxylate;2,2,2-trifluoroacetate.
| Compound Name | methyl (2S,4S)-4-acetylsulfanylpyrrolidin-1-ium-2-carboxylate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10686951 |
| Molecular Formula | C10H14F3NO5S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | methyl (2S,4S)-4-acetylsulfanylpyrrolidin-1-ium-2-carboxylate;2,2,2-trifluoroacetate |
| SMILES | COC(=O)[C@@H]1C[C@H](SC(C)=O)C[NH2+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C8H13NO3S.C2HF3O2/c1-5(10)13-6-3-7(9-4-6)8(11)12-2;3-2(4,5)1(6)7/h6-7,9H,3-4H2,1-2H3;(H,6,7)/t6-,7-;/m0./s1 |
| InChIKey | IWAFGKOEYGZKEW-LEUCUCNGSA-N |
| XLogP | -1.56 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|