C10H12F3NO4S — CID 88778797
(2,2,2-trifluoroacetyl) 3-[(2S)-pyrrolidine-2-carbonyl]sulfanylpropanoate (PubChem CID 88778797) has the molecular formula C10H12F3NO4S and a molecular weight of 299.27 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[(2S)-pyrrolidine-2-carbonyl]sulfanylpropanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[(2S)-pyrrolidine-2-carbonyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 88778797 |
| Molecular Formula | C10H12F3NO4S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[(2S)-pyrrolidine-2-carbonyl]sulfanylpropanoate |
| SMILES | O=C(CCSC(=O)[C@@H]1CCCN1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO4S/c11-10(12,13)9(17)18-7(15)3-5-19-8(16)6-2-1-4-14-6/h6,14H,1-5H2/t6-/m0/s1 |
| InChIKey | UFKIEGWZFFSUMR-LURJTMIESA-N |
| XLogP | 1.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|