C11H15F3NNaO4S — CID 173442598
sodium;[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2S)-pyrrolidine-2-carboxylate;hydride (PubChem CID 173442598) has the molecular formula C11H15F3NNaO4S and a molecular weight of 337.30 g/mol. Its IUPAC name is sodium;[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2S)-pyrrolidine-2-carboxylate;hydride.
| Compound Name | sodium;[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2S)-pyrrolidine-2-carboxylate;hydride |
|---|---|
| PubChem CID | 173442598 |
| Molecular Formula | C11H15F3NNaO4S |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | sodium;[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl] (2S)-pyrrolidine-2-carboxylate;hydride |
| SMILES | CC(=O)SCC(C(=O)OC(=O)[C@@H]1CCCN1)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C11H14F3NO4S.Na.H/c1-6(16)20-5-7(11(12,13)14)9(17)19-10(18)8-3-2-4-15-8;;/h7-8,15H,2-5H2,1H3;;/q;+1;-1/t7?,8-;;/m0../s1 |
| InChIKey | JJFLHVWDBAYKCU-AEUOCKLGSA-N |
| XLogP | -1.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|