C15H21F3N2O5S — CID 88629603
(2,2,2-trifluoroacetyl) (2S)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]pyrrolidine-2-carboxylate (PubChem CID 88629603) has the molecular formula C15H21F3N2O5S and a molecular weight of 398.40 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88629603 |
| Molecular Formula | C15H21F3N2O5S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-1-[2-(acetylsulfanylmethyl)-5-aminopentanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(=O)SCC(CCCN)C(=O)N1CCC[C@H]1C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O5S/c1-9(21)26-8-10(4-2-6-19)12(22)20-7-3-5-11(20)13(23)25-14(24)15(16,17)18/h10-11H,2-8,19H2,1H3/t10?,11-/m0/s1 |
| InChIKey | VAOAIALPTTVRIN-DTIOYNMSSA-N |
| XLogP | 1.24 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|