C15H15BrN2 — CID 106876518
1-(3-bromo-4-methyl-2-pyridinyl)-3,4-dihydro-2H-quinoline (PubChem CID 106876518) has the molecular formula C15H15BrN2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-(3-bromo-4-methyl-2-pyridinyl)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(3-bromo-4-methyl-2-pyridinyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 106876518 |
| Molecular Formula | C15H15BrN2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-(3-bromo-4-methyl-2-pyridinyl)-3,4-dihydro-2H-quinoline |
| SMILES | Cc1ccnc(N2CCCc3ccccc32)c1Br |
| InChI | InChI=1S/C15H15BrN2/c1-11-8-9-17-15(14(11)16)18-10-4-6-12-5-2-3-7-13(12)18/h2-3,5,7-9H,4,6,10H2,1H3 |
| InChIKey | HNZGRUOAVLCXMY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |