C13H10FNO4 — CID 106876782
(4-fluoro-2,6-dimethylphenyl)-(5-nitrofuran-2-yl)methanone (PubChem CID 106876782) has the molecular formula C13H10FNO4 and a molecular weight of 263.22 g/mol. Its IUPAC name is (4-fluoro-2,6-dimethylphenyl)-(5-nitrofuran-2-yl)methanone.
| Compound Name | (4-fluoro-2,6-dimethylphenyl)-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 106876782 |
| Molecular Formula | C13H10FNO4 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (4-fluoro-2,6-dimethylphenyl)-(5-nitrofuran-2-yl)methanone |
| SMILES | Cc1cc(F)cc(C)c1C(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H10FNO4/c1-7-5-9(14)6-8(2)12(7)13(16)10-3-4-11(19-10)15(17)18/h3-6H,1-2H3 |
| InChIKey | GMXZJURISUBXRS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|