C26H16 — CID 10687737
(24S,25S)-heptacyclo[11.10.2.13,7.02,12.017,25.020,24.011,26]hexacosa-1(23),2(12),3,5,7(26),8,10,13,15,17,19,21-dodecaene (PubChem CID 10687737) has the molecular formula C26H16 and a molecular weight of 328.41 g/mol. Its IUPAC name is (24S,25S)-heptacyclo[11.10.2.13,7.02,12.017,25.020,24.011,26]hexacosa-1(23),2(12),3,5,7(26),8,10,13,15,17,19,21-dodecaene.
| Compound Name | (24S,25S)-heptacyclo[11.10.2.13,7.02,12.017,25.020,24.011,26]hexacosa-1(23),2(12),3,5,7(26),8,10,13,15,17,19,21-dodecaene |
|---|---|
| PubChem CID | 10687737 |
| Molecular Formula | C26H16 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (24S,25S)-heptacyclo[11.10.2.13,7.02,12.017,25.020,24.011,26]hexacosa-1(23),2(12),3,5,7(26),8,10,13,15,17,19,21-dodecaene |
| SMILES | C1=CC2=CC=C3C=CC=C4C5=C(C(=C1)[C@H]2[C@@H]34)c1cccc2cccc5c12 |
| InChI | InChI=1S/C26H16/c1-5-15-6-2-10-19-22(15)18(9-1)25-20-11-3-7-16-13-14-17-8-4-12-21(26(19)25)24(17)23(16)20/h1-14,23-24H/t23-,24-/m0/s1 |
| InChIKey | DDQSVSAMIOMUDY-ZEQRLZLVSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |