C20H20N2 — CID 101400560
1-N,2-N-di(cyclobutyl)acenaphthylene-1,2-diimine (PubChem CID 101400560) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-N,2-N-di(cyclobutyl)acenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-di(cyclobutyl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 101400560 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-N,2-N-di(cyclobutyl)acenaphthylene-1,2-diimine |
| SMILES | c1cc2c3c(cccc3c1)C(=N\C1CCC1)/C2=N\C1CCC1 |
| InChI | InChI=1S/C20H20N2/c1-5-13-6-2-12-17-18(13)16(11-1)19(21-14-7-3-8-14)20(17)22-15-9-4-10-15/h1-2,5-6,11-12,14-15H,3-4,7-10H2/b21-19-,22-20+ |
| InChIKey | QVQFXSJWUDKEOK-OLAQIDGISA-N |
| XLogP | 4.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|