C27H40N2 — CID 158540199
7a,11a-dihydroacenaphthyleno[1,2-b]quinoxaline;ethane;methane (PubChem CID 158540199) has the molecular formula C27H40N2 and a molecular weight of 392.63 g/mol. Its IUPAC name is 7a,11a-dihydroacenaphthyleno[1,2-b]quinoxaline;ethane;methane.
| Compound Name | 7a,11a-dihydroacenaphthyleno[1,2-b]quinoxaline;ethane;methane |
|---|---|
| PubChem CID | 158540199 |
| Molecular Formula | C27H40N2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 7a,11a-dihydroacenaphthyleno[1,2-b]quinoxaline;ethane;methane |
| SMILES | C.C1=CC2N=C3C(=NC2C=C1)c1cccc2cccc3c12.CC.CC.CC.CC |
| InChI | InChI=1S/C18H12N2.4C2H6.CH4/c1-2-10-15-14(9-1)19-17-12-7-3-5-11-6-4-8-13(16(11)12)18(17)20-15;4*1-2;/h1-10,14-15H;4*1-2H3;1H4 |
| InChIKey | HOKQHENHXDOXOF-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |