C14H7NO — CID 67437408
acenaphthyleno[2,1-b]pyrrol-8-one (PubChem CID 67437408) has the molecular formula C14H7NO and a molecular weight of 205.22 g/mol. Its IUPAC name is acenaphthyleno[2,1-b]pyrrol-8-one.
| Compound Name | acenaphthyleno[2,1-b]pyrrol-8-one |
|---|---|
| PubChem CID | 67437408 |
| Molecular Formula | C14H7NO |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | acenaphthyleno[2,1-b]pyrrol-8-one |
| SMILES | O=C1C=C2C(=N1)c1cccc3cccc2c13 |
| InChI | InChI=1S/C14H7NO/c16-12-7-11-9-5-1-3-8-4-2-6-10(13(8)9)14(11)15-12/h1-7H |
| InChIKey | UTZLITLAKQUPAQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |