About (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone
(2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 106883197) has the molecular formula C13H12FNOS
and a molecular weight of 249.31 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone.
Molecular Properties
| Compound Name | (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone |
| PubChem CID | 106883197 |
| Molecular Formula | C13H12FNOS |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2scnc2C)c(F)c1 |
| InChI | InChI=1S/C13H12FNOS/c1-7-4-8(2)11(10(14)5-7)12(16)13-9(3)15-6-17-13/h4-6H,1-3H3 |
| InChIKey | MFLZGJSZPLCILC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone?
The IUPAC name of (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone (CID 106883197) is (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone.
What is the SMILES notation for (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone?
The canonical SMILES for (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone is Cc1cc(C)c(C(=O)c2scnc2C)c(F)c1.
What is the InChIKey of (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone?
The InChIKey is MFLZGJSZPLCILC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNOS/c1-7-4-8(2)11(10(14)5-7)12(16)13-9(3)15-6-17-13/h4-6H,1-3H3.
What are the key properties of (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone?
(2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone has a molecular weight of 249.31 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-4,6-dimethylphenyl)-(4-methyl-1,3-thiazol-5-yl)methanone is sourced from PubChem (CID 106883197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).