About (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone
(2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone (PubChem CID 106883260) has the molecular formula C12H11FN2OS
and a molecular weight of 250.30 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone.
Molecular Properties
| Compound Name | (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone |
| PubChem CID | 106883260 |
| Molecular Formula | C12H11FN2OS |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2snnc2C)c(F)c1 |
| InChI | InChI=1S/C12H11FN2OS/c1-6-4-7(2)10(9(13)5-6)11(16)12-8(3)14-15-17-12/h4-5H,1-3H3 |
| InChIKey | JWXLFEFETFRBNI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone?
The IUPAC name of (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone (CID 106883260) is (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone.
What is the SMILES notation for (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone?
The canonical SMILES for (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone is Cc1cc(C)c(C(=O)c2snnc2C)c(F)c1.
What is the InChIKey of (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone?
The InChIKey is JWXLFEFETFRBNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2OS/c1-6-4-7(2)10(9(13)5-6)11(16)12-8(3)14-15-17-12/h4-5H,1-3H3.
What are the key properties of (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone?
(2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone has a molecular weight of 250.30 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-4,6-dimethylphenyl)-(4-methylthiadiazol-5-yl)methanone is sourced from PubChem (CID 106883260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).