C13H14FN3 — CID 106883516
(2-fluoro-4,6-dimethylphenyl)-pyrimidin-5-ylmethanamine (PubChem CID 106883516) has the molecular formula C13H14FN3 and a molecular weight of 231.27 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylphenyl)-pyrimidin-5-ylmethanamine.
| Compound Name | (2-fluoro-4,6-dimethylphenyl)-pyrimidin-5-ylmethanamine |
|---|---|
| PubChem CID | 106883516 |
| Molecular Formula | C13H14FN3 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (2-fluoro-4,6-dimethylphenyl)-pyrimidin-5-ylmethanamine |
| SMILES | Cc1cc(C)c(C(N)c2cncnc2)c(F)c1 |
| InChI | InChI=1S/C13H14FN3/c1-8-3-9(2)12(11(14)4-8)13(15)10-5-16-7-17-6-10/h3-7,13H,15H2,1-2H3 |
| InChIKey | BXYISFPUDXZISO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |