C11H12FN3S — CID 106883927
(2-fluoro-4,6-dimethylphenyl)-(thiadiazol-5-yl)methanamine (PubChem CID 106883927) has the molecular formula C11H12FN3S and a molecular weight of 237.30 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylphenyl)-(thiadiazol-5-yl)methanamine.
| Compound Name | (2-fluoro-4,6-dimethylphenyl)-(thiadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 106883927 |
| Molecular Formula | C11H12FN3S |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | (2-fluoro-4,6-dimethylphenyl)-(thiadiazol-5-yl)methanamine |
| SMILES | Cc1cc(C)c(C(N)c2cnns2)c(F)c1 |
| InChI | InChI=1S/C11H12FN3S/c1-6-3-7(2)10(8(12)4-6)11(13)9-5-14-15-16-9/h3-5,11H,13H2,1-2H3 |
| InChIKey | GYQDBDSIRAHDSG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |