C13H16N2OS — CID 105084249
1-(thiadiazol-5-yl)-2-(2,4,6-trimethylphenyl)ethanol (PubChem CID 105084249) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-(thiadiazol-5-yl)-2-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 1-(thiadiazol-5-yl)-2-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 105084249 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(thiadiazol-5-yl)-2-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(CC(O)c2cnns2)c(C)c1 |
| InChI | InChI=1S/C13H16N2OS/c1-8-4-9(2)11(10(3)5-8)6-12(16)13-7-14-15-17-13/h4-5,7,12,16H,6H2,1-3H3 |
| InChIKey | SFGNSZUPZQGXGU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |