C14H16INOS — CID 112755578
1-(5-iodo-1,3-thiazol-2-yl)-2-(2,4,6-trimethylphenyl)ethanol (PubChem CID 112755578) has the molecular formula C14H16INOS and a molecular weight of 373.26 g/mol. Its IUPAC name is 1-(5-iodo-1,3-thiazol-2-yl)-2-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 1-(5-iodo-1,3-thiazol-2-yl)-2-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 112755578 |
| Molecular Formula | C14H16INOS |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1-(5-iodo-1,3-thiazol-2-yl)-2-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(CC(O)c2ncc(I)s2)c(C)c1 |
| InChI | InChI=1S/C14H16INOS/c1-8-4-9(2)11(10(3)5-8)6-12(17)14-16-7-13(15)18-14/h4-5,7,12,17H,6H2,1-3H3 |
| InChIKey | CQMIFBRHLDIPLL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|