C15H25FN2O — CID 106884445
[2-ethyl-1-(2-fluoro-4,6-dimethylphenyl)-2-methoxybutyl]hydrazine (PubChem CID 106884445) has the molecular formula C15H25FN2O and a molecular weight of 268.38 g/mol. Its IUPAC name is [2-ethyl-1-(2-fluoro-4,6-dimethylphenyl)-2-methoxybutyl]hydrazine.
| Compound Name | [2-ethyl-1-(2-fluoro-4,6-dimethylphenyl)-2-methoxybutyl]hydrazine |
|---|---|
| PubChem CID | 106884445 |
| Molecular Formula | C15H25FN2O |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | [2-ethyl-1-(2-fluoro-4,6-dimethylphenyl)-2-methoxybutyl]hydrazine |
| SMILES | CCC(CC)(OC)C(NN)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C15H25FN2O/c1-6-15(7-2,19-5)14(18-17)13-11(4)8-10(3)9-12(13)16/h8-9,14,18H,6-7,17H2,1-5H3 |
| InChIKey | NDFVLGWQPXPGRJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|