C13H21BrN2O — CID 106885648
1-(3-bromofuran-2-yl)-N-butyl-N-cyclopropylethane-1,2-diamine (PubChem CID 106885648) has the molecular formula C13H21BrN2O and a molecular weight of 301.23 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-N-butyl-N-cyclopropylethane-1,2-diamine.
| Compound Name | 1-(3-bromofuran-2-yl)-N-butyl-N-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 106885648 |
| Molecular Formula | C13H21BrN2O |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-N-butyl-N-cyclopropylethane-1,2-diamine |
| SMILES | CCCCN(C1CC1)C(CN)c1occc1Br |
| InChI | InChI=1S/C13H21BrN2O/c1-2-3-7-16(10-4-5-10)12(9-15)13-11(14)6-8-17-13/h6,8,10,12H,2-5,7,9,15H2,1H3 |
| InChIKey | RYFLTEXWKWLIPG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |