C13H22N2O — CID 63208501
N-butyl-N-cyclopropyl-1-(furan-3-yl)ethane-1,2-diamine (PubChem CID 63208501) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-butyl-N-cyclopropyl-1-(furan-3-yl)ethane-1,2-diamine.
| Compound Name | N-butyl-N-cyclopropyl-1-(furan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63208501 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-butyl-N-cyclopropyl-1-(furan-3-yl)ethane-1,2-diamine |
| SMILES | CCCCN(C1CC1)C(CN)c1ccoc1 |
| InChI | InChI=1S/C13H22N2O/c1-2-3-7-15(12-4-5-12)13(9-14)11-6-8-16-10-11/h6,8,10,12-13H,2-5,7,9,14H2,1H3 |
| InChIKey | CXGMNMQBURLKMP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |