C17H29N3 — CID 61441069
N-butyl-N-cyclopropyl-1-[4-(dimethylamino)phenyl]ethane-1,2-diamine (PubChem CID 61441069) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is N-butyl-N-cyclopropyl-1-[4-(dimethylamino)phenyl]ethane-1,2-diamine.
| Compound Name | N-butyl-N-cyclopropyl-1-[4-(dimethylamino)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 61441069 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | N-butyl-N-cyclopropyl-1-[4-(dimethylamino)phenyl]ethane-1,2-diamine |
| SMILES | CCCCN(C1CC1)C(CN)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H29N3/c1-4-5-12-20(16-10-11-16)17(13-18)14-6-8-15(9-7-14)19(2)3/h6-9,16-17H,4-5,10-13,18H2,1-3H3 |
| InChIKey | CLWACZQVIPCDOV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|