C13H19BrO2 — CID 106886249
(3-bromofuran-2-yl)-(3,4-dimethylcyclohexyl)methanol (PubChem CID 106886249) has the molecular formula C13H19BrO2 and a molecular weight of 287.20 g/mol. Its IUPAC name is (3-bromofuran-2-yl)-(3,4-dimethylcyclohexyl)methanol.
| Compound Name | (3-bromofuran-2-yl)-(3,4-dimethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 106886249 |
| Molecular Formula | C13H19BrO2 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (3-bromofuran-2-yl)-(3,4-dimethylcyclohexyl)methanol |
| SMILES | CC1CCC(C(O)c2occc2Br)CC1C |
| InChI | InChI=1S/C13H19BrO2/c1-8-3-4-10(7-9(8)2)12(15)13-11(14)5-6-16-13/h5-6,8-10,12,15H,3-4,7H2,1-2H3 |
| InChIKey | YPJZNVJDFWNURM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |