C11H15BrO3 — CID 106886280
1-(3-bromofuran-2-yl)-2-(oxan-4-yl)ethanol (PubChem CID 106886280) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is 1-(3-bromofuran-2-yl)-2-(oxan-4-yl)ethanol.
| Compound Name | 1-(3-bromofuran-2-yl)-2-(oxan-4-yl)ethanol |
|---|---|
| PubChem CID | 106886280 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-(3-bromofuran-2-yl)-2-(oxan-4-yl)ethanol |
| SMILES | OC(CC1CCOCC1)c1occc1Br |
| InChI | InChI=1S/C11H15BrO3/c12-9-3-6-15-11(9)10(13)7-8-1-4-14-5-2-8/h3,6,8,10,13H,1-2,4-5,7H2 |
| InChIKey | NRWMJJLAWASUFL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |